C19H35N3O2 — CID 99778459
(3R)-1-[2-[(1-cycloheptyl-2-methylpropan-2-yl)amino]acetyl]piperidine-3-carboxamide (PubChem CID 99778459) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is (3R)-1-[2-[(1-cycloheptyl-2-methylpropan-2-yl)amino]acetyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-[(1-cycloheptyl-2-methylpropan-2-yl)amino]acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99778459 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | (3R)-1-[2-[(1-cycloheptyl-2-methylpropan-2-yl)amino]acetyl]piperidine-3-carboxamide |
| SMILES | CC(C)(CC1CCCCCC1)NCC(=O)N1CCC[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C19H35N3O2/c1-19(2,12-15-8-5-3-4-6-9-15)21-13-17(23)22-11-7-10-16(14-22)18(20)24/h15-16,21H,3-14H2,1-2H3,(H2,20,24)/t16-/m1/s1 |
| InChIKey | NSJYRRGGKIMWCM-MRXNPFEDSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |