C18H25NOS — CID 65294128
3-ethoxy-N-(2-prop-2-enylsulfanylphenyl)spiro[3.3]heptan-1-amine (PubChem CID 65294128) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 3-ethoxy-N-(2-prop-2-enylsulfanylphenyl)spiro[3.3]heptan-1-amine.
| Compound Name | 3-ethoxy-N-(2-prop-2-enylsulfanylphenyl)spiro[3.3]heptan-1-amine |
|---|---|
| PubChem CID | 65294128 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-ethoxy-N-(2-prop-2-enylsulfanylphenyl)spiro[3.3]heptan-1-amine |
| SMILES | C=CCSc1ccccc1NC1CC(OCC)C12CCC2 |
| InChI | InChI=1S/C18H25NOS/c1-3-12-21-15-9-6-5-8-14(15)19-16-13-17(20-4-2)18(16)10-7-11-18/h3,5-6,8-9,16-17,19H,1,4,7,10-13H2,2H3 |
| InChIKey | XMCXNKXEKKFOTF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|