C17H22N2OS — CID 65295134
N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxyspiro[3.3]heptan-1-amine (PubChem CID 65295134) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxyspiro[3.3]heptan-1-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxyspiro[3.3]heptan-1-amine |
|---|---|
| PubChem CID | 65295134 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-ethoxyspiro[3.3]heptan-1-amine |
| SMILES | CCOC1CC(NCc2nc3ccccc3s2)C12CCC2 |
| InChI | InChI=1S/C17H22N2OS/c1-2-20-15-10-14(17(15)8-5-9-17)18-11-16-19-12-6-3-4-7-13(12)21-16/h3-4,6-7,14-15,18H,2,5,8-11H2,1H3 |
| InChIKey | LKPUALQARRIIJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |