C16H21F2NOS — CID 65295421
N-[2-(difluoromethylsulfanyl)phenyl]-3-ethoxyspiro[3.3]heptan-1-amine (PubChem CID 65295421) has the molecular formula C16H21F2NOS and a molecular weight of 313.41 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-3-ethoxyspiro[3.3]heptan-1-amine.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-ethoxyspiro[3.3]heptan-1-amine |
|---|---|
| PubChem CID | 65295421 |
| Molecular Formula | C16H21F2NOS |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-ethoxyspiro[3.3]heptan-1-amine |
| SMILES | CCOC1CC(Nc2ccccc2SC(F)F)C12CCC2 |
| InChI | InChI=1S/C16H21F2NOS/c1-2-20-14-10-13(16(14)8-5-9-16)19-11-6-3-4-7-12(11)21-15(17)18/h3-4,6-7,13-15,19H,2,5,8-10H2,1H3 |
| InChIKey | UGJDBOMXYCNBLN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |