C14H26N2S — CID 65296351
3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine (PubChem CID 65296351) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine.
| Compound Name | 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 65296351 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine |
| SMILES | Cc1ccc(CNCCCC(C)(C)CCN)s1 |
| InChI | InChI=1S/C14H26N2S/c1-12-5-6-13(17-12)11-16-10-4-7-14(2,3)8-9-15/h5-6,16H,4,7-11,15H2,1-3H3 |
| InChIKey | GWBYDIJQDJAUIA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|