About 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine
3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine (PubChem CID 65296351) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine.
Molecular Properties
| Compound Name | 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine |
| PubChem CID | 65296351 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine |
| SMILES | Cc1ccc(CNCCCC(C)(C)CCN)s1 |
| InChI | InChI=1S/C14H26N2S/c1-12-5-6-13(17-12)11-16-10-4-7-14(2,3)8-9-15/h5-6,16H,4,7-11,15H2,1-3H3 |
| InChIKey | GWBYDIJQDJAUIA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine?
The IUPAC name of 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine (CID 65296351) is 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine.
What is the SMILES notation for 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine?
The canonical SMILES for 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine is Cc1ccc(CNCCCC(C)(C)CCN)s1.
What is the InChIKey of 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine?
The InChIKey is GWBYDIJQDJAUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-12-5-6-13(17-12)11-16-10-4-7-14(2,3)8-9-15/h5-6,16H,4,7-11,15H2,1-3H3.
What are the key properties of 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine?
3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine has a molecular weight of 254.44 g/mol, XLogP of 3.30, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N'-[(5-methylthiophen-2-yl)methyl]hexane-1,6-diamine is sourced from PubChem (CID 65296351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).