C17H23NO3 — CID 65301285
1-[2-hydroxy-2-(4-propylphenyl)ethyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 65301285) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(4-propylphenyl)ethyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-hydroxy-2-(4-propylphenyl)ethyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 65301285 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[2-hydroxy-2-(4-propylphenyl)ethyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CCCc1ccc(C(O)CN2C(=O)CC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-4-5-12-6-8-13(9-7-12)14(19)11-18-15(20)10-17(2,3)16(18)21/h6-9,14,19H,4-5,10-11H2,1-3H3 |
| InChIKey | DJOSUIGCMZWDFF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|