C17H27NO3 — CID 65302518
4-[2-adamantyl(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65302518) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[2-adamantyl(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[2-adamantyl(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65302518 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 4-[2-adamantyl(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CN(C(=O)CC(C)(C)C(=O)O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H27NO3/c1-17(2,16(20)21)9-14(19)18(3)15-12-5-10-4-11(7-12)8-13(15)6-10/h10-13,15H,4-9H2,1-3H3,(H,20,21) |
| InChIKey | ZTWHDOIBLMJFSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |