C20H33N — CID 65308449
N-(2-methylpropyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine (PubChem CID 65308449) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-(2-methylpropyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine.
| Compound Name | N-(2-methylpropyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 65308449 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-(2-methylpropyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine |
| SMILES | CC(C)CNCCCCCCc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H33N/c1-17(2)16-21-14-8-4-3-5-9-18-12-13-19-10-6-7-11-20(19)15-18/h12-13,15,17,21H,3-11,14,16H2,1-2H3 |
| InChIKey | RYZDFIUKNDOPGG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|