C15H23F2N — CID 113329285
4-[3-(difluoromethyl)phenyl]-N-(2-methylpropyl)butan-1-amine (PubChem CID 113329285) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)phenyl]-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 4-[3-(difluoromethyl)phenyl]-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 113329285 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 4-[3-(difluoromethyl)phenyl]-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCCCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C15H23F2N/c1-12(2)11-18-9-4-3-6-13-7-5-8-14(10-13)15(16)17/h5,7-8,10,12,15,18H,3-4,6,9,11H2,1-2H3 |
| InChIKey | NXIKUIAGXJWHLS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|