C13H17BrClNO2 — CID 65309176
5-bromo-N-(2-chloro-3-methoxypropyl)-N,2-dimethylbenzamide (PubChem CID 65309176) has the molecular formula C13H17BrClNO2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 5-bromo-N-(2-chloro-3-methoxypropyl)-N,2-dimethylbenzamide.
| Compound Name | 5-bromo-N-(2-chloro-3-methoxypropyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 65309176 |
| Molecular Formula | C13H17BrClNO2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-bromo-N-(2-chloro-3-methoxypropyl)-N,2-dimethylbenzamide |
| SMILES | COCC(Cl)CN(C)C(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C13H17BrClNO2/c1-9-4-5-10(14)6-12(9)13(17)16(2)7-11(15)8-18-3/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | FSSZCYYUCBIASA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|