C16H14Br2O — CID 65311708
5-[bromo-(5-bromo-2-methylphenyl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 65311708) has the molecular formula C16H14Br2O and a molecular weight of 382.10 g/mol. Its IUPAC name is 5-[bromo-(5-bromo-2-methylphenyl)methyl]-1,3-dihydro-2-benzofuran.
| Compound Name | 5-[bromo-(5-bromo-2-methylphenyl)methyl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 65311708 |
| Molecular Formula | C16H14Br2O |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 5-[bromo-(5-bromo-2-methylphenyl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | Cc1ccc(Br)cc1C(Br)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C16H14Br2O/c1-10-2-5-14(17)7-15(10)16(18)11-3-4-12-8-19-9-13(12)6-11/h2-7,16H,8-9H2,1H3 |
| InChIKey | DZAJSIHGCXHBRU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|