C14H22N2O3 — CID 65312704
4-(diethylamino)-N-(1,3-dihydroxypropan-2-yl)benzamide (PubChem CID 65312704) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(diethylamino)-N-(1,3-dihydroxypropan-2-yl)benzamide.
| Compound Name | 4-(diethylamino)-N-(1,3-dihydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 65312704 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-(diethylamino)-N-(1,3-dihydroxypropan-2-yl)benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)NC(CO)CO)cc1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-16(4-2)13-7-5-11(6-8-13)14(19)15-12(9-17)10-18/h5-8,12,17-18H,3-4,9-10H2,1-2H3,(H,15,19) |
| InChIKey | HBZZDUCSDWCKIA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |