C17H26N2O6 — CID 139765270
4-(diethylamino)-N-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide (PubChem CID 139765270) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 4-(diethylamino)-N-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide.
| Compound Name | 4-(diethylamino)-N-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 139765270 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-(diethylamino)-N-[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)N[C@@H](C=O)[C@H](O)[C@@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C17H26N2O6/c1-3-19(4-2)12-7-5-11(6-8-12)17(25)18-13(9-20)15(23)16(24)14(22)10-21/h5-9,13-16,21-24H,3-4,10H2,1-2H3,(H,18,25)/t13-,14+,15-,16-/m0/s1 |
| InChIKey | OFWKVJDXWMYIGI-FZKCQIBNSA-N |
| XLogP | -1.09 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|