C8H17N3O7 — CID 129010038
[methyl-[(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamoyl]amino]-oxidoazanium (PubChem CID 129010038) has the molecular formula C8H17N3O7 and a molecular weight of 267.24 g/mol. Its IUPAC name is [methyl-[(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamoyl]amino]-oxidoazanium.
| Compound Name | [methyl-[(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamoyl]amino]-oxidoazanium |
|---|---|
| PubChem CID | 129010038 |
| Molecular Formula | C8H17N3O7 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [methyl-[(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)carbamoyl]amino]-oxidoazanium |
| SMILES | CN([NH2+][O-])C(=O)NC(C=O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17N3O7/c1-11(10-18)8(17)9-4(2-12)6(15)7(16)5(14)3-13/h2,4-7,13-16H,3,10H2,1H3,(H,9,17) |
| InChIKey | VUVHIMLGTHRGQZ-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 170.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|