C12H16N2O2 — CID 65313203
3-(1,3-dihydroxypropan-2-ylamino)-2-phenylpropanenitrile (PubChem CID 65313203) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(1,3-dihydroxypropan-2-ylamino)-2-phenylpropanenitrile.
| Compound Name | 3-(1,3-dihydroxypropan-2-ylamino)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 65313203 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(1,3-dihydroxypropan-2-ylamino)-2-phenylpropanenitrile |
| SMILES | N#CC(CNC(CO)CO)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c13-6-11(7-14-12(8-15)9-16)10-4-2-1-3-5-10/h1-5,11-12,14-16H,7-9H2 |
| InChIKey | MEHHAKFOYXRDRJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |