C15H22N2 — CID 64535813
3-(4-methylpentan-2-ylamino)-2-phenylpropanenitrile (PubChem CID 64535813) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-(4-methylpentan-2-ylamino)-2-phenylpropanenitrile.
| Compound Name | 3-(4-methylpentan-2-ylamino)-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 64535813 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(4-methylpentan-2-ylamino)-2-phenylpropanenitrile |
| SMILES | CC(C)CC(C)NCC(C#N)c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-12(2)9-13(3)17-11-15(10-16)14-7-5-4-6-8-14/h4-8,12-13,15,17H,9,11H2,1-3H3 |
| InChIKey | KRHKGZNRQIQZLJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |