C9H21NO2 — CID 65315712
2-(2-methylpentylamino)propane-1,3-diol (PubChem CID 65315712) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-(2-methylpentylamino)propane-1,3-diol.
| Compound Name | 2-(2-methylpentylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 65315712 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 2-(2-methylpentylamino)propane-1,3-diol |
| SMILES | CCCC(C)CNC(CO)CO |
| InChI | InChI=1S/C9H21NO2/c1-3-4-8(2)5-10-9(6-11)7-12/h8-12H,3-7H2,1-2H3 |
| InChIKey | DADXYQLENFGOBD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |