C17H18Cl2O — CID 65316614
1-(2,5-dichlorophenyl)-2-(2,5-dimethylphenyl)propan-2-ol (PubChem CID 65316614) has the molecular formula C17H18Cl2O and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,5-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 65316614 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1ccc(C)c(C(C)(O)Cc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2O/c1-11-4-5-12(2)15(8-11)17(3,20)10-13-9-14(18)6-7-16(13)19/h4-9,20H,10H2,1-3H3 |
| InChIKey | CVKGODBFSGUPAB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |