C13H16Cl3N — CID 65318449
3-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine (PubChem CID 65318449) has the molecular formula C13H16Cl3N and a molecular weight of 292.64 g/mol. Its IUPAC name is 3-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine.
| Compound Name | 3-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 65318449 |
| Molecular Formula | C13H16Cl3N |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-(chloromethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine |
| SMILES | ClCC1CCCN(Cc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C13H16Cl3N/c14-7-10-2-1-5-17(8-10)9-11-6-12(15)3-4-13(11)16/h3-4,6,10H,1-2,5,7-9H2 |
| InChIKey | OINLRIAHERSOKP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|