C14H18BrCl2N — CID 80690764
3-(2-bromoethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine (PubChem CID 80690764) has the molecular formula C14H18BrCl2N and a molecular weight of 351.12 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine.
| Compound Name | 3-(2-bromoethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 80690764 |
| Molecular Formula | C14H18BrCl2N |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 3-(2-bromoethyl)-1-[(2,5-dichlorophenyl)methyl]piperidine |
| SMILES | Clc1ccc(Cl)c(CN2CCCC(CCBr)C2)c1 |
| InChI | InChI=1S/C14H18BrCl2N/c15-6-5-11-2-1-7-18(9-11)10-12-8-13(16)3-4-14(12)17/h3-4,8,11H,1-2,5-7,9-10H2 |
| InChIKey | FDPZMLKPBVTUST-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|