C13H15Cl2NO — CID 65318635
1-[(2,5-dichlorophenyl)methyl]piperidine-4-carbaldehyde (PubChem CID 65318635) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is 1-[(2,5-dichlorophenyl)methyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[(2,5-dichlorophenyl)methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 65318635 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-[(2,5-dichlorophenyl)methyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c14-12-1-2-13(15)11(7-12)8-16-5-3-10(9-17)4-6-16/h1-2,7,9-10H,3-6,8H2 |
| InChIKey | JVXQRCLJBGTLAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|