C17H25ClN2 — CID 65319403
1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(2-chlorophenyl)propan-2-amine (PubChem CID 65319403) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(2-chlorophenyl)propan-2-amine.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(2-chlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 65319403 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1-(2-chlorophenyl)propan-2-amine |
| SMILES | CC(N)C(c1ccccc1Cl)N1CCCC2CCCC21 |
| InChI | InChI=1S/C17H25ClN2/c1-12(19)17(14-8-2-3-9-15(14)18)20-11-5-7-13-6-4-10-16(13)20/h2-3,8-9,12-13,16-17H,4-7,10-11,19H2,1H3 |
| InChIKey | HZXYFYZEDAYWIA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |