C17H22ClNO2 — CID 65320123
1-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chloro-2-hydroxyphenyl]ethanone (PubChem CID 65320123) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chloro-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chloro-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 65320123 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-5-chloro-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)cc(CN2CCCC3CCCC32)c1O |
| InChI | InChI=1S/C17H22ClNO2/c1-11(20)15-9-14(18)8-13(17(15)21)10-19-7-3-5-12-4-2-6-16(12)19/h8-9,12,16,21H,2-7,10H2,1H3 |
| InChIKey | BKGHZDRUOGPSSJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|