C19H15NO3S — CID 6532078
4-[(Z)-[3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde (PubChem CID 6532078) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-[(Z)-[3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde.
| Compound Name | 4-[(Z)-[3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 6532078 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[(Z)-[3-(2,3-dimethylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
| SMILES | Cc1cccc(N2C(=O)S/C(=C\c3ccc(C=O)cc3)C2=O)c1C |
| InChI | InChI=1S/C19H15NO3S/c1-12-4-3-5-16(13(12)2)20-18(22)17(24-19(20)23)10-14-6-8-15(11-21)9-7-14/h3-11H,1-2H3/b17-10- |
| InChIKey | MISNQTYOKWZMBY-YVLHZVERSA-N |
| XLogP | 4.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|