C13H11BrO4S — CID 65322037
3-[(2-bromo-5-methoxyphenyl)methoxy]thiophene-2-carboxylic acid (PubChem CID 65322037) has the molecular formula C13H11BrO4S and a molecular weight of 343.20 g/mol. Its IUPAC name is 3-[(2-bromo-5-methoxyphenyl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-bromo-5-methoxyphenyl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 65322037 |
| Molecular Formula | C13H11BrO4S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 3-[(2-bromo-5-methoxyphenyl)methoxy]thiophene-2-carboxylic acid |
| SMILES | COc1ccc(Br)c(COc2ccsc2C(=O)O)c1 |
| InChI | InChI=1S/C13H11BrO4S/c1-17-9-2-3-10(14)8(6-9)7-18-11-4-5-19-12(11)13(15)16/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | IBOSOOVOZWYNHH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |