C17H16BrNO2 — CID 65326077
1-[(2-bromo-5-methoxyphenyl)methyl]-3,4-dihydroquinolin-2-one (PubChem CID 65326077) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 65326077 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc(Br)c(CN2C(=O)CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H16BrNO2/c1-21-14-7-8-15(18)13(10-14)11-19-16-5-3-2-4-12(16)6-9-17(19)20/h2-5,7-8,10H,6,9,11H2,1H3 |
| InChIKey | UCDMYASNJXOCAW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |