C12H13NO3 — CID 153165592
2-(7-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)acetaldehyde (PubChem CID 153165592) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(7-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)acetaldehyde.
| Compound Name | 2-(7-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 153165592 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(7-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)acetaldehyde |
| SMILES | COc1ccc2c(c1)N(CC=O)C(=O)CC2 |
| InChI | InChI=1S/C12H13NO3/c1-16-10-4-2-9-3-5-12(15)13(6-7-14)11(9)8-10/h2,4,7-8H,3,5-6H2,1H3 |
| InChIKey | WDEPQRBKROAILO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|