C17H24N2O2 — CID 141163160
7-methoxy-1-(2-piperidin-1-ylethyl)-3,4-dihydroquinolin-2-one (PubChem CID 141163160) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 7-methoxy-1-(2-piperidin-1-ylethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 7-methoxy-1-(2-piperidin-1-ylethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 141163160 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 7-methoxy-1-(2-piperidin-1-ylethyl)-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc2c(c1)N(CCN1CCCCC1)C(=O)CC2 |
| InChI | InChI=1S/C17H24N2O2/c1-21-15-7-5-14-6-8-17(20)19(16(14)13-15)12-11-18-9-3-2-4-10-18/h5,7,13H,2-4,6,8-12H2,1H3 |
| InChIKey | RGAJFDUNQRGCFM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |