C12H12FNO2 — CID 63041512
3-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)propanal (PubChem CID 63041512) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)propanal.
| Compound Name | 3-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)propanal |
|---|---|
| PubChem CID | 63041512 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-(7-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)propanal |
| SMILES | O=CCCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H12FNO2/c13-10-4-2-9-3-5-12(16)14(6-1-7-15)11(9)8-10/h2,4,7-8H,1,3,5-6H2 |
| InChIKey | UVYXLJGAIKLHEM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|