C16H21FN2O — CID 103071710
7-fluoro-1-[2-(propylaminomethyl)prop-2-enyl]-3,4-dihydroquinolin-2-one (PubChem CID 103071710) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 7-fluoro-1-[2-(propylaminomethyl)prop-2-enyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 7-fluoro-1-[2-(propylaminomethyl)prop-2-enyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 103071710 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 7-fluoro-1-[2-(propylaminomethyl)prop-2-enyl]-3,4-dihydroquinolin-2-one |
| SMILES | C=C(CNCCC)CN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C16H21FN2O/c1-3-8-18-10-12(2)11-19-15-9-14(17)6-4-13(15)5-7-16(19)20/h4,6,9,18H,2-3,5,7-8,10-11H2,1H3 |
| InChIKey | VJAHGZNIEZEEQC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|