C14H19FN2O — CID 61387630
7-fluoro-1-[2-(propylamino)ethyl]-3,4-dihydroquinolin-2-one (PubChem CID 61387630) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 7-fluoro-1-[2-(propylamino)ethyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 7-fluoro-1-[2-(propylamino)ethyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 61387630 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 7-fluoro-1-[2-(propylamino)ethyl]-3,4-dihydroquinolin-2-one |
| SMILES | CCCNCCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H19FN2O/c1-2-7-16-8-9-17-13-10-12(15)5-3-11(13)4-6-14(17)18/h3,5,10,16H,2,4,6-9H2,1H3 |
| InChIKey | NVYJBOZWRMXTFR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|