C14H18BNO4S — CID 65327496
[4-methoxy-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]phenyl]boronic acid (PubChem CID 65327496) has the molecular formula C14H18BNO4S and a molecular weight of 307.18 g/mol. Its IUPAC name is [4-methoxy-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 65327496 |
| Molecular Formula | C14H18BNO4S |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [4-methoxy-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(COCCc2scnc2C)c1 |
| InChI | InChI=1S/C14H18BNO4S/c1-10-14(21-9-16-10)5-6-20-8-11-7-12(19-2)3-4-13(11)15(17)18/h3-4,7,9,17-18H,5-6,8H2,1-2H3 |
| InChIKey | KITRPSAYMRCSFW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|