C13H15BrN2OS — CID 60790887
3-bromo-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]aniline (PubChem CID 60790887) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is 3-bromo-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]aniline.
| Compound Name | 3-bromo-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]aniline |
|---|---|
| PubChem CID | 60790887 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-bromo-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxymethyl]aniline |
| SMILES | Cc1ncsc1CCOCc1ccc(N)cc1Br |
| InChI | InChI=1S/C13H15BrN2OS/c1-9-13(18-8-16-9)4-5-17-7-10-2-3-11(15)6-12(10)14/h2-3,6,8H,4-5,7,15H2,1H3 |
| InChIKey | PFKVECVIYAQGBA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|