C22H23N7O — CID 6532793
(Z)-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide (PubChem CID 6532793) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is (Z)-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6532793 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (Z)-N-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)NC(c1nc2ccccc2[nH]1)C(C)C |
| InChI | InChI=1S/C22H23N7O/c1-14(2)20(21-23-17-11-7-8-12-18(17)24-21)25-22(30)19(29-15(3)26-27-28-29)13-16-9-5-4-6-10-16/h4-14,20H,1-3H3,(H,23,24)(H,25,30)/b19-13- |
| InChIKey | OMUWGYDYDLBHMT-UYRXBGFRSA-N |
| XLogP | 3.37 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|