C11H12N6O2 — CID 653281
8-imidazol-1-yl-1,3,7-trimethylpurine-2,6-dione (PubChem CID 653281) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 8-imidazol-1-yl-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-imidazol-1-yl-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 653281 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 8-imidazol-1-yl-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(-n3ccnc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C11H12N6O2/c1-14-7-8(13-10(14)17-5-4-12-6-17)15(2)11(19)16(3)9(7)18/h4-6H,1-3H3 |
| InChIKey | YMMKIRDZDXEBEP-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |