C12H13N3O2 — CID 65331224
4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 65331224) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 65331224 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2nc(C3CCCO3)no2)cc1 |
| InChI | InChI=1S/C12H13N3O2/c13-9-5-3-8(4-6-9)12-14-11(15-17-12)10-2-1-7-16-10/h3-6,10H,1-2,7,13H2 |
| InChIKey | BDYMDAJLEPPZIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|