C12H12N2O4 — CID 136904136
4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol (PubChem CID 136904136) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol.
| Compound Name | 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136904136 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-[3-(oxolan-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nc(C3CCCO3)no2)c(O)c1 |
| InChI | InChI=1S/C12H12N2O4/c15-7-3-4-8(9(16)6-7)12-13-11(14-18-12)10-2-1-5-17-10/h3-4,6,10,15-16H,1-2,5H2 |
| InChIKey | QLKGNNYGWWUUSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |