C13H22N4O2 — CID 65331884
3-(oxan-3-yl)-5-(1-piperazin-1-ylethyl)-1,2,4-oxadiazole (PubChem CID 65331884) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(oxan-3-yl)-5-(1-piperazin-1-ylethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(oxan-3-yl)-5-(1-piperazin-1-ylethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 65331884 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-(oxan-3-yl)-5-(1-piperazin-1-ylethyl)-1,2,4-oxadiazole |
| SMILES | CC(c1nc(C2CCCOC2)no1)N1CCNCC1 |
| InChI | InChI=1S/C13H22N4O2/c1-10(17-6-4-14-5-7-17)13-15-12(16-19-13)11-3-2-8-18-9-11/h10-11,14H,2-9H2,1H3 |
| InChIKey | SHKLPEWRUQLYOF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |