C10H16N4O — CID 65334319
4-ethyl-6-(oxan-4-yl)-1,3,5-triazin-2-amine (PubChem CID 65334319) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-ethyl-6-(oxan-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethyl-6-(oxan-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65334319 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4-ethyl-6-(oxan-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCc1nc(N)nc(C2CCOCC2)n1 |
| InChI | InChI=1S/C10H16N4O/c1-2-8-12-9(14-10(11)13-8)7-3-5-15-6-4-7/h7H,2-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | PENJPMFZJYKADZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |