C12H21N5O — CID 79662449
4-ethyl-6-(4-propan-2-ylmorpholin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 79662449) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-ethyl-6-(4-propan-2-ylmorpholin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethyl-6-(4-propan-2-ylmorpholin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79662449 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-ethyl-6-(4-propan-2-ylmorpholin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCc1nc(N)nc(C2CN(C(C)C)CCO2)n1 |
| InChI | InChI=1S/C12H21N5O/c1-4-10-14-11(16-12(13)15-10)9-7-17(8(2)3)5-6-18-9/h8-9H,4-7H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | GODVGCFUSFGYPK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |