C12H21N3O2 — CID 65334686
1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-amine (PubChem CID 65334686) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-amine.
| Compound Name | 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
|---|---|
| PubChem CID | 65334686 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
| SMILES | CCCC(N)Cc1nc(C2CCOCC2)no1 |
| InChI | InChI=1S/C12H21N3O2/c1-2-3-10(13)8-11-14-12(15-17-11)9-4-6-16-7-5-9/h9-10H,2-8,13H2,1H3 |
| InChIKey | APWLLVULBXTXDJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |