About 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol
3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol (PubChem CID 65337677) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol |
| PubChem CID | 65337677 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol |
| SMILES | Cc1nn(C(C)C)c(C)c1NC(C)C(C)(C)O |
| InChI | InChI=1S/C13H25N3O/c1-8(2)16-10(4)12(9(3)15-16)14-11(5)13(6,7)17/h8,11,14,17H,1-7H3 |
| InChIKey | XGIZJWCZIRTZBU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol?
The IUPAC name of 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol (CID 65337677) is 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol.
What is the SMILES notation for 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol?
The canonical SMILES for 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol is Cc1nn(C(C)C)c(C)c1NC(C)C(C)(C)O.
What is the InChIKey of 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol?
The InChIKey is XGIZJWCZIRTZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-8(2)16-10(4)12(9(3)15-16)14-11(5)13(6,7)17/h8,11,14,17H,1-7H3.
What are the key properties of 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol?
3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol has a molecular weight of 239.36 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)amino]-2-methylbutan-2-ol is sourced from PubChem (CID 65337677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).