C15H23N3OS — CID 65340377
5-[(2,6-dimethylthiomorpholin-4-yl)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 65340377) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 5-[(2,6-dimethylthiomorpholin-4-yl)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 5-[(2,6-dimethylthiomorpholin-4-yl)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 65340377 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 5-[(2,6-dimethylthiomorpholin-4-yl)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CN2CC(C)SC(C)C2)ccc1OC |
| InChI | InChI=1S/C15H23N3OS/c1-10-7-18(8-11(2)20-10)9-12-4-5-14(19-3)13(6-12)15(16)17/h4-6,10-11H,7-9H2,1-3H3,(H3,16,17) |
| InChIKey | PDUVBGRIGOOGNG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|