C12H13IN4O — CID 65340287
5-[(4-iodopyrazol-1-yl)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 65340287) has the molecular formula C12H13IN4O and a molecular weight of 356.17 g/mol. Its IUPAC name is 5-[(4-iodopyrazol-1-yl)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 5-[(4-iodopyrazol-1-yl)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 65340287 |
| Molecular Formula | C12H13IN4O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-[(4-iodopyrazol-1-yl)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cn2cc(I)cn2)ccc1OC |
| InChI | InChI=1S/C12H13IN4O/c1-18-11-3-2-8(4-10(11)12(14)15)6-17-7-9(13)5-16-17/h2-5,7H,6H2,1H3,(H3,14,15) |
| InChIKey | GXGLRMCVZWUJPQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|