C16H24N2O2 — CID 65340715
2-methoxy-5-[[2-(3-methylbutoxy)ethylamino]methyl]benzonitrile (PubChem CID 65340715) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-methoxy-5-[[2-(3-methylbutoxy)ethylamino]methyl]benzonitrile.
| Compound Name | 2-methoxy-5-[[2-(3-methylbutoxy)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 65340715 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-methoxy-5-[[2-(3-methylbutoxy)ethylamino]methyl]benzonitrile |
| SMILES | COc1ccc(CNCCOCCC(C)C)cc1C#N |
| InChI | InChI=1S/C16H24N2O2/c1-13(2)6-8-20-9-7-18-12-14-4-5-16(19-3)15(10-14)11-17/h4-5,10,13,18H,6-9,12H2,1-3H3 |
| InChIKey | FLYQTXLZYYYPDO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|