C9H8BrN3S2 — CID 65342054
4-bromo-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline (PubChem CID 65342054) has the molecular formula C9H8BrN3S2 and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-bromo-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline.
| Compound Name | 4-bromo-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 65342054 |
| Molecular Formula | C9H8BrN3S2 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 300.93 |
| IUPAC Name | 4-bromo-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
| SMILES | Cc1nnc(Sc2cc(Br)ccc2N)s1 |
| InChI | InChI=1S/C9H8BrN3S2/c1-5-12-13-9(14-5)15-8-4-6(10)2-3-7(8)11/h2-4H,11H2,1H3 |
| InChIKey | ACIZTSNEUPMWCG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|