C10H10ClN3S2 — CID 115555574
2-chloro-5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline (PubChem CID 115555574) has the molecular formula C10H10ClN3S2 and a molecular weight of 271.80 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline.
| Compound Name | 2-chloro-5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 115555574 |
| Molecular Formula | C10H10ClN3S2 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-chloro-5-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
| SMILES | Cc1nnc(Sc2cc(Cl)c(N)cc2C)s1 |
| InChI | InChI=1S/C10H10ClN3S2/c1-5-3-8(12)7(11)4-9(5)16-10-14-13-6(2)15-10/h3-4H,12H2,1-2H3 |
| InChIKey | AUIMJAGYRZHSLX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|