C10H7ClN2OS2 — CID 81159058
3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzaldehyde (PubChem CID 81159058) has the molecular formula C10H7ClN2OS2 and a molecular weight of 270.77 g/mol. Its IUPAC name is 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzaldehyde.
| Compound Name | 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 81159058 |
| Molecular Formula | C10H7ClN2OS2 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzaldehyde |
| SMILES | Cc1nnc(Sc2ccc(C=O)cc2Cl)s1 |
| InChI | InChI=1S/C10H7ClN2OS2/c1-6-12-13-10(15-6)16-9-3-2-7(5-14)4-8(9)11/h2-5H,1H3 |
| InChIKey | ZCAJXITZQXOFLB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|