C11H15BrN2S — CID 65343311
4-bromo-2-N-methyl-2-N-(thiolan-3-yl)benzene-1,2-diamine (PubChem CID 65343311) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 4-bromo-2-N-methyl-2-N-(thiolan-3-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-methyl-2-N-(thiolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343311 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-bromo-2-N-methyl-2-N-(thiolan-3-yl)benzene-1,2-diamine |
| SMILES | CN(c1cc(Br)ccc1N)C1CCSC1 |
| InChI | InChI=1S/C11H15BrN2S/c1-14(9-4-5-15-7-9)11-6-8(12)2-3-10(11)13/h2-3,6,9H,4-5,7,13H2,1H3 |
| InChIKey | ANWJEXLLQDMGAR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|