C11H16N2S — CID 93278897
4-N-methyl-4-N-[(3R)-thiolan-3-yl]benzene-1,4-diamine (PubChem CID 93278897) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(3R)-thiolan-3-yl]benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(3R)-thiolan-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 93278897 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-N-methyl-4-N-[(3R)-thiolan-3-yl]benzene-1,4-diamine |
| SMILES | CN(c1ccc(N)cc1)[C@@H]1CCSC1 |
| InChI | InChI=1S/C11H16N2S/c1-13(11-6-7-14-8-11)10-4-2-9(12)3-5-10/h2-5,11H,6-8,12H2,1H3/t11-/m1/s1 |
| InChIKey | RRBHVWBDBYUDIM-LLVKDONJSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|